C13H24N4O2 — CID 135190383
1,3-diamino-1-[(4Z,6Z)-9-methoxy-7-methylnona-1,4,6-trien-2-yl]-3-methylurea (PubChem CID 135190383) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1,3-diamino-1-[(4Z,6Z)-9-methoxy-7-methylnona-1,4,6-trien-2-yl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[(4Z,6Z)-9-methoxy-7-methylnona-1,4,6-trien-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 135190383 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1,3-diamino-1-[(4Z,6Z)-9-methoxy-7-methylnona-1,4,6-trien-2-yl]-3-methylurea |
| SMILES | C=C(C/C=C\C=C(\C)CCOC)N(N)C(=O)N(C)N |
| InChI | InChI=1S/C13H24N4O2/c1-11(9-10-19-4)7-5-6-8-12(2)17(15)13(18)16(3)14/h5-7H,2,8-10,14-15H2,1,3-4H3/b6-5-,11-7- |
| InChIKey | IJBWYMHJGCJAEM-FUVGTJSASA-N |
| XLogP | 1.53 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|