C23H24N2O7S2 — CID 138504187
[2-[(4-methoxyphenyl)sulfonylamino]-3,4-dihydro-1H-isoquinolin-5-yl] 4-methoxybenzenesulfonate (PubChem CID 138504187) has the molecular formula C23H24N2O7S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)sulfonylamino]-3,4-dihydro-1H-isoquinolin-5-yl] 4-methoxybenzenesulfonate.
| Compound Name | [2-[(4-methoxyphenyl)sulfonylamino]-3,4-dihydro-1H-isoquinolin-5-yl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 138504187 |
| Molecular Formula | C23H24N2O7S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | [2-[(4-methoxyphenyl)sulfonylamino]-3,4-dihydro-1H-isoquinolin-5-yl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)NN2CCc3c(cccc3OS(=O)(=O)c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C23H24N2O7S2/c1-30-18-6-10-20(11-7-18)33(26,27)24-25-15-14-22-17(16-25)4-3-5-23(22)32-34(28,29)21-12-8-19(31-2)9-13-21/h3-13,24H,14-16H2,1-2H3 |
| InChIKey | MGBSEHCNDHANNJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|