C12H16N2 — CID 138509502
(2Z,5Z)-2,4-dimethyl-6-(prop-2-enylideneamino)hepta-2,5-dienenitrile (PubChem CID 138509502) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2Z,5Z)-2,4-dimethyl-6-(prop-2-enylideneamino)hepta-2,5-dienenitrile.
| Compound Name | (2Z,5Z)-2,4-dimethyl-6-(prop-2-enylideneamino)hepta-2,5-dienenitrile |
|---|---|
| PubChem CID | 138509502 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (2Z,5Z)-2,4-dimethyl-6-(prop-2-enylideneamino)hepta-2,5-dienenitrile |
| SMILES | C=C/C=N/C(C)=C\C(C)/C=C(/C)C#N |
| InChI | InChI=1S/C12H16N2/c1-5-6-14-12(4)8-10(2)7-11(3)9-13/h5-8,10H,1H2,2-4H3/b11-7-,12-8-,14-6+ |
| InChIKey | AKOWSQYEPGVNGD-PEINTIOPSA-N |
| XLogP | 3.25 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|