C24H28N2O3 — CID 138510093
5-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1,5-dimethyl-3-[2-oxo-2-(9-tricyclo[4.2.1.12,5]deca-1,5-dienyl)ethyl]imidazolidine-2,4-dione (PubChem CID 138510093) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 5-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1,5-dimethyl-3-[2-oxo-2-(9-tricyclo[4.2.1.12,5]deca-1,5-dienyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1,5-dimethyl-3-[2-oxo-2-(9-tricyclo[4.2.1.12,5]deca-1,5-dienyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138510093 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 5-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1,5-dimethyl-3-[2-oxo-2-(9-tricyclo[4.2.1.12,5]deca-1,5-dienyl)ethyl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(CC(=O)C2C3=C4CCC(=C2CC3)C4)C(=O)C1(C)C1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C24H28N2O3/c1-24(19-10-13-3-4-16(19)9-13)22(28)26(23(29)25(24)2)12-20(27)21-17-7-8-18(21)15-6-5-14(17)11-15/h3-4,13,16,19,21H,5-12H2,1-2H3/t13-,16+,19?,24?/m0/s1 |
| InChIKey | WCPRALVXBNQCNC-SVYNDEHESA-N |
| XLogP | 3.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|