C23H28N2O5 — CID 138510343
5-[(1Z,3Z)-2,5-diethoxyhexa-1,3,5-trienyl]-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione (PubChem CID 138510343) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 5-[(1Z,3Z)-2,5-diethoxyhexa-1,3,5-trienyl]-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione.
| Compound Name | 5-[(1Z,3Z)-2,5-diethoxyhexa-1,3,5-trienyl]-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138510343 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 5-[(1Z,3Z)-2,5-diethoxyhexa-1,3,5-trienyl]-1,5-dimethyl-3-phenacylimidazolidine-2,4-dione |
| SMILES | C=C(/C=C\C(=C\C1(C)C(=O)N(CC(=O)c2ccccc2)C(=O)N1C)OCC)OCC |
| InChI | InChI=1S/C23H28N2O5/c1-6-29-17(3)13-14-19(30-7-2)15-23(4)21(27)25(22(28)24(23)5)16-20(26)18-11-9-8-10-12-18/h8-15H,3,6-7,16H2,1-2,4-5H3/b14-13-,19-15- |
| InChIKey | AHTWDGHQZWZICH-ISSFDRLWSA-N |
| XLogP | 3.55 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|