C22H33N5O8S — CID 138510760
2-amino-3-[1-[3-[2-[2-(6-cyano-4-methanimidoyl-3-oxohexoxy)ethoxy]ethylamino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 138510760) has the molecular formula C22H33N5O8S and a molecular weight of 527.60 g/mol. Its IUPAC name is 2-amino-3-[1-[3-[2-[2-(6-cyano-4-methanimidoyl-3-oxohexoxy)ethoxy]ethylamino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[1-[3-[2-[2-(6-cyano-4-methanimidoyl-3-oxohexoxy)ethoxy]ethylamino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 138510760 |
| Molecular Formula | C22H33N5O8S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 2-amino-3-[1-[3-[2-[2-(6-cyano-4-methanimidoyl-3-oxohexoxy)ethoxy]ethylamino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | [H]/N=C/C(CCC#N)C(=O)CCOCCOCCNC(=O)CCN1C(=O)CC(SCC(N)C(=O)O)C1=O |
| InChI | InChI=1S/C22H33N5O8S/c23-5-1-2-15(13-24)17(28)4-8-34-10-11-35-9-6-26-19(29)3-7-27-20(30)12-18(21(27)31)36-14-16(25)22(32)33/h13,15-16,18,24H,1-4,6-12,14,25H2,(H,26,29)(H,32,33)/b24-13+ |
| InChIKey | QXHZEYJSASJHPL-ZMOGYAJESA-N |
| XLogP | -0.67 |
| TPSA | 212.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|