C19H33N4O10PS — CID 157225926
methyl [4-[2-[3-[3-[2-(methylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethoxy]butanoylamino]methyl hydrogen phosphate (PubChem CID 157225926) has the molecular formula C19H33N4O10PS and a molecular weight of 540.53 g/mol. Its IUPAC name is methyl [4-[2-[3-[3-[2-(methylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethoxy]butanoylamino]methyl hydrogen phosphate.
| Compound Name | methyl [4-[2-[3-[3-[2-(methylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethoxy]butanoylamino]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 157225926 |
| Molecular Formula | C19H33N4O10PS |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | methyl [4-[2-[3-[3-[2-(methylamino)-3-oxopropyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethoxy]butanoylamino]methyl hydrogen phosphate |
| SMILES | CNC(C=O)CSC1CC(=O)N(CCC(=O)NCCOCCCC(=O)NCOP(=O)(O)OC)C1=O |
| InChI | InChI=1S/C19H33N4O10PS/c1-20-14(11-24)12-35-15-10-18(27)23(19(15)28)7-5-17(26)21-6-9-32-8-3-4-16(25)22-13-33-34(29,30)31-2/h11,14-15,20H,3-10,12-13H2,1-2H3,(H,21,26)(H,22,25)(H,29,30) |
| InChIKey | VRTIYJOXVOZWNU-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 189.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|