C20H23ClN2O3S — CID 138511657
N-(6-chloro-1,3-benzothiazol-2-yl)-5-(4,5-dimethoxycyclohexa-1,3-dien-1-yl)pentanamide (PubChem CID 138511657) has the molecular formula C20H23ClN2O3S and a molecular weight of 406.94 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-5-(4,5-dimethoxycyclohexa-1,3-dien-1-yl)pentanamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-5-(4,5-dimethoxycyclohexa-1,3-dien-1-yl)pentanamide |
|---|---|
| PubChem CID | 138511657 |
| Molecular Formula | C20H23ClN2O3S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-5-(4,5-dimethoxycyclohexa-1,3-dien-1-yl)pentanamide |
| SMILES | COC1=CC=C(CCCCC(=O)Nc2nc3ccc(Cl)cc3s2)CC1OC |
| InChI | InChI=1S/C20H23ClN2O3S/c1-25-16-10-7-13(11-17(16)26-2)5-3-4-6-19(24)23-20-22-15-9-8-14(21)12-18(15)27-20/h7-10,12,17H,3-6,11H2,1-2H3,(H,22,23,24) |
| InChIKey | UGCVQEIHTHBSTO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|