C17H18N6S — CID 138513901
4-[(E)-1H-indol-3-ylmethylideneamino]-3-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 138513901) has the molecular formula C17H18N6S and a molecular weight of 338.44 g/mol. Its IUPAC name is 4-[(E)-1H-indol-3-ylmethylideneamino]-3-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-1H-indol-3-ylmethylideneamino]-3-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 138513901 |
| Molecular Formula | C17H18N6S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-[(E)-1H-indol-3-ylmethylideneamino]-3-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | C/C=C(\C=C/NC)c1n[nH]c(=S)n1/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H18N6S/c1-3-12(8-9-18-2)16-21-22-17(24)23(16)20-11-13-10-19-15-7-5-4-6-14(13)15/h3-11,18-19H,1-2H3,(H,22,24)/b9-8-,12-3+,20-11+ |
| InChIKey | MMSFBBHCIWWDRY-RKYUNKHNSA-N |
| XLogP | 3.44 |
| TPSA | 73.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|