C15H30N2 — CID 138519658
1-N'-ethyl-3,7-dimethyl-1-N'-prop-2-enyloct-6-ene-1,1-diamine (PubChem CID 138519658) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 1-N'-ethyl-3,7-dimethyl-1-N'-prop-2-enyloct-6-ene-1,1-diamine.
| Compound Name | 1-N'-ethyl-3,7-dimethyl-1-N'-prop-2-enyloct-6-ene-1,1-diamine |
|---|---|
| PubChem CID | 138519658 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 1-N'-ethyl-3,7-dimethyl-1-N'-prop-2-enyloct-6-ene-1,1-diamine |
| SMILES | C=CCN(CC)C(N)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C15H30N2/c1-6-11-17(7-2)15(16)12-14(5)10-8-9-13(3)4/h6,9,14-15H,1,7-8,10-12,16H2,2-5H3 |
| InChIKey | SUTNUUIAHYBEGO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|