C28H26F4N7O2+ — CID 138528241
2-[[4-[5-amino-6-(2-amino-2-methylpropoxy)pyrazin-2-yl]phenyl]methylimino]-N-(4-fluorophenyl)-5-(trifluoromethyl)pyridin-5-ylium-3-carboxamide (PubChem CID 138528241) has the molecular formula C28H26F4N7O2+ and a molecular weight of 568.56 g/mol. Its IUPAC name is 2-[[4-[5-amino-6-(2-amino-2-methylpropoxy)pyrazin-2-yl]phenyl]methylimino]-N-(4-fluorophenyl)-5-(trifluoromethyl)pyridin-5-ylium-3-carboxamide.
| Compound Name | 2-[[4-[5-amino-6-(2-amino-2-methylpropoxy)pyrazin-2-yl]phenyl]methylimino]-N-(4-fluorophenyl)-5-(trifluoromethyl)pyridin-5-ylium-3-carboxamide |
|---|---|
| PubChem CID | 138528241 |
| Molecular Formula | C28H26F4N7O2+ |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 2-[[4-[5-amino-6-(2-amino-2-methylpropoxy)pyrazin-2-yl]phenyl]methylimino]-N-(4-fluorophenyl)-5-(trifluoromethyl)pyridin-5-ylium-3-carboxamide |
| SMILES | CC(C)(N)COc1nc(-c2ccc(C/N=C3\N=C[C+](C(F)(F)F)C=C3C(=O)Nc3ccc(F)cc3)cc2)cnc1N |
| InChI | InChI=1S/C28H25F4N7O2/c1-27(2,34)15-41-26-23(33)35-14-22(39-26)17-5-3-16(4-6-17)12-36-24-21(11-18(13-37-24)28(30,31)32)25(40)38-20-9-7-19(29)8-10-20/h3-11,13-14H,12,15,34H2,1-2H3,(H2-,33,35,38,40)/p+1/b36-24- |
| InChIKey | CRIZRTKEWKXCCD-IBTHDSTKSA-O |
| XLogP | 4.67 |
| TPSA | 140.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|