C15H26N2O6S — CID 138531936
ethyl 2,2-dimethyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]sulfanyloxypropanoate (PubChem CID 138531936) has the molecular formula C15H26N2O6S and a molecular weight of 362.45 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]sulfanyloxypropanoate.
| Compound Name | ethyl 2,2-dimethyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]sulfanyloxypropanoate |
|---|---|
| PubChem CID | 138531936 |
| Molecular Formula | C15H26N2O6S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | ethyl 2,2-dimethyl-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]sulfanyloxypropanoate |
| SMILES | CCOC(=O)C(C)(C)COSN1CC(NC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C15H26N2O6S/c1-7-21-12(19)15(5,6)9-22-24-17-8-10(11(17)18)16-13(20)23-14(2,3)4/h10H,7-9H2,1-6H3,(H,16,20) |
| InChIKey | VPCLHAXYLJPSOK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|