C12H14F3N5O5 — CID 139641677
tert-butyl N-[(3S)-1-[4-nitro-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-oxoazetidin-3-yl]carbamate (PubChem CID 139641677) has the molecular formula C12H14F3N5O5 and a molecular weight of 365.27 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[4-nitro-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-oxoazetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[4-nitro-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-oxoazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 139641677 |
| Molecular Formula | C12H14F3N5O5 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | tert-butyl N-[(3S)-1-[4-nitro-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-oxoazetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN(c2n[nH]c(C(F)(F)F)c2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C12H14F3N5O5/c1-11(2,3)25-10(22)16-5-4-19(9(5)21)8-6(20(23)24)7(17-18-8)12(13,14)15/h5H,4H2,1-3H3,(H,16,22)(H,17,18)/t5-/m0/s1 |
| InChIKey | IIVOEDMCVAFKNP-YFKPBYRVSA-N |
| XLogP | 1.58 |
| TPSA | 130.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|