C16H28N2O2 — CID 138532959
tert-butyl N-[(4E,6Z)-1-amino-4,7-dimethylnona-4,6,8-trien-2-yl]carbamate (PubChem CID 138532959) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is tert-butyl N-[(4E,6Z)-1-amino-4,7-dimethylnona-4,6,8-trien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4E,6Z)-1-amino-4,7-dimethylnona-4,6,8-trien-2-yl]carbamate |
|---|---|
| PubChem CID | 138532959 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | tert-butyl N-[(4E,6Z)-1-amino-4,7-dimethylnona-4,6,8-trien-2-yl]carbamate |
| SMILES | C=C/C(C)=C\C=C(/C)CC(CN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O2/c1-7-12(2)8-9-13(3)10-14(11-17)18-15(19)20-16(4,5)6/h7-9,14H,1,10-11,17H2,2-6H3,(H,18,19)/b12-8-,13-9+ |
| InChIKey | JKKDDSLTZAFVHB-QRBCZBMESA-N |
| XLogP | 3.31 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|