C11H15N3O2 — CID 138546911
(2S)-2-amino-3-[4-(2-amino-2-iminoethyl)phenyl]propanoic acid (PubChem CID 138546911) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(2-amino-2-iminoethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-(2-amino-2-iminoethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 138546911 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (2S)-2-amino-3-[4-(2-amino-2-iminoethyl)phenyl]propanoic acid |
| SMILES | [H]/N=C(\N)Cc1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C11H15N3O2/c12-9(11(15)16)5-7-1-3-8(4-2-7)6-10(13)14/h1-4,9H,5-6,12H2,(H3,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | KZBNEQBDBAVNGO-VIFPVBQESA-N |
| XLogP | 0.12 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|