C20H20F3NO7 — CID 138549762
2-[[4-(3-acetyl-5,5,5-trifluoro-4-oxopentanoyl)phenoxy]carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 138549762) has the molecular formula C20H20F3NO7 and a molecular weight of 443.37 g/mol. Its IUPAC name is 2-[[4-(3-acetyl-5,5,5-trifluoro-4-oxopentanoyl)phenoxy]carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[4-(3-acetyl-5,5,5-trifluoro-4-oxopentanoyl)phenoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138549762 |
| Molecular Formula | C20H20F3NO7 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-[[4-(3-acetyl-5,5,5-trifluoro-4-oxopentanoyl)phenoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)Oc1ccc(C(=O)CC(C(C)=O)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO7/c1-11(2)18(28)30-9-8-24-19(29)31-14-6-4-13(5-7-14)16(26)10-15(12(3)25)17(27)20(21,22)23/h4-7,15H,1,8-10H2,2-3H3,(H,24,29) |
| InChIKey | FOCJBQOAOYOWRB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|