C25H29F3O9 — CID 159085944
[4-[6-(2-methoxyethoxy)-4-oxo-3-(2,2,2-trifluoroacetyl)hexanoyl]phenyl] 4-(2-methylprop-2-enoyloxy)butanoate (PubChem CID 159085944) has the molecular formula C25H29F3O9 and a molecular weight of 530.49 g/mol. Its IUPAC name is [4-[6-(2-methoxyethoxy)-4-oxo-3-(2,2,2-trifluoroacetyl)hexanoyl]phenyl] 4-(2-methylprop-2-enoyloxy)butanoate.
| Compound Name | [4-[6-(2-methoxyethoxy)-4-oxo-3-(2,2,2-trifluoroacetyl)hexanoyl]phenyl] 4-(2-methylprop-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 159085944 |
| Molecular Formula | C25H29F3O9 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [4-[6-(2-methoxyethoxy)-4-oxo-3-(2,2,2-trifluoroacetyl)hexanoyl]phenyl] 4-(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)Oc1ccc(C(=O)CC(C(=O)CCOCCOC)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H29F3O9/c1-16(2)24(33)36-11-4-5-22(31)37-18-8-6-17(7-9-18)21(30)15-19(23(32)25(26,27)28)20(29)10-12-35-14-13-34-3/h6-9,19H,1,4-5,10-15H2,2-3H3 |
| InChIKey | CYASXNMMOUGQFJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|