C8H14S2 — CID 138567195
(2S)-2-methyl-3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]thiopyran (PubChem CID 138567195) has the molecular formula C8H14S2 and a molecular weight of 174.33 g/mol. Its IUPAC name is (2S)-2-methyl-3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]thiopyran.
| Compound Name | (2S)-2-methyl-3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]thiopyran |
|---|---|
| PubChem CID | 138567195 |
| Molecular Formula | C8H14S2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (2S)-2-methyl-3,3a,5,6,7,7a-hexahydro-2H-thieno[3,2-b]thiopyran |
| SMILES | C[C@H]1CC2SCCCC2S1 |
| InChI | InChI=1S/C8H14S2/c1-6-5-8-7(10-6)3-2-4-9-8/h6-8H,2-5H2,1H3/t6-,7?,8?/m0/s1 |
| InChIKey | HCTUEWRRRCPKDQ-KKMMWDRVSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |