C38H14F6N6 — CID 138572724
2-[2,7-bis[2-cyano-4-(trifluoromethyl)phenyl]-10-(dicyanomethylidene)-4b,9b-dihydroindeno[2,1-a]inden-5-ylidene]propanedinitrile (PubChem CID 138572724) has the molecular formula C38H14F6N6 and a molecular weight of 668.56 g/mol. Its IUPAC name is 2-[2,7-bis[2-cyano-4-(trifluoromethyl)phenyl]-10-(dicyanomethylidene)-4b,9b-dihydroindeno[2,1-a]inden-5-ylidene]propanedinitrile.
| Compound Name | 2-[2,7-bis[2-cyano-4-(trifluoromethyl)phenyl]-10-(dicyanomethylidene)-4b,9b-dihydroindeno[2,1-a]inden-5-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 138572724 |
| Molecular Formula | C38H14F6N6 |
| Molecular Weight | 668.56 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | 2-[2,7-bis[2-cyano-4-(trifluoromethyl)phenyl]-10-(dicyanomethylidene)-4b,9b-dihydroindeno[2,1-a]inden-5-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(-c3ccc(C(F)(F)F)cc3C#N)ccc2C2C(=C(C#N)C#N)c3cc(-c4ccc(C(F)(F)F)cc4C#N)ccc3C12 |
| InChI | InChI=1S/C38H14F6N6/c39-37(40,41)25-3-7-27(21(9-25)13-45)19-1-5-29-31(11-19)33(23(15-47)16-48)36-30-6-2-20(12-32(30)34(35(29)36)24(17-49)18-50)28-8-4-26(38(42,43)44)10-22(28)14-46/h1-12,35-36H |
| InChIKey | NFNMZTVVLKDRML-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.56 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|