C23H22N4O3 — CID 138574871
3-[7-[(E)-5-(4-ethynylpyrazol-1-yl)pent-1-enyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 138574871) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-[7-[(E)-5-(4-ethynylpyrazol-1-yl)pent-1-enyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[(E)-5-(4-ethynylpyrazol-1-yl)pent-1-enyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 138574871 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-[7-[(E)-5-(4-ethynylpyrazol-1-yl)pent-1-enyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C#Cc1cnn(CCC/C=C/c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C23H22N4O3/c1-2-16-13-24-26(14-16)12-5-3-4-7-17-8-6-9-18-19(17)15-27(23(18)30)20-10-11-21(28)25-22(20)29/h1,4,6-9,13-14,20H,3,5,10-12,15H2,(H,25,28,29)/b7-4+ |
| InChIKey | ZVSMGVSFONXXEW-QPJJXVBHSA-N |
| XLogP | 2.12 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|