C30H29N7O — CID 138578010
[4-[(15E)-11-oxa-2,4,19,21,23,30-hexazapentacyclo[18.6.2.23,6.05,10.024,28]triaconta-1(27),3(30),4,6(29),7,9,15,20,22,24(28),25-undecaen-22-yl]phenyl]methanamine (PubChem CID 138578010) has the molecular formula C30H29N7O and a molecular weight of 503.61 g/mol. Its IUPAC name is [4-[(15E)-11-oxa-2,4,19,21,23,30-hexazapentacyclo[18.6.2.23,6.05,10.024,28]triaconta-1(27),3(30),4,6(29),7,9,15,20,22,24(28),25-undecaen-22-yl]phenyl]methanamine.
| Compound Name | [4-[(15E)-11-oxa-2,4,19,21,23,30-hexazapentacyclo[18.6.2.23,6.05,10.024,28]triaconta-1(27),3(30),4,6(29),7,9,15,20,22,24(28),25-undecaen-22-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 138578010 |
| Molecular Formula | C30H29N7O |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | [4-[(15E)-11-oxa-2,4,19,21,23,30-hexazapentacyclo[18.6.2.23,6.05,10.024,28]triaconta-1(27),3(30),4,6(29),7,9,15,20,22,24(28),25-undecaen-22-yl]phenyl]methanamine |
| SMILES | NCc1ccc(-c2nc3c4cc(ccc4n2)Nc2ncc4cccc(c4n2)OCCC/C=C/CCN3)cc1 |
| InChI | InChI=1S/C30H29N7O/c31-18-20-9-11-21(12-10-20)28-35-25-14-13-23-17-24(25)29(37-28)32-15-4-2-1-3-5-16-38-26-8-6-7-22-19-33-30(34-23)36-27(22)26/h1-2,6-14,17,19H,3-5,15-16,18,31H2,(H,32,35,37)(H,33,34,36)/b2-1+ |
| InChIKey | WOXRZCLNWRCBGZ-OWOJBTEDSA-N |
| XLogP | 5.97 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|