C11H15N3O4S — CID 138595290
4-[(4-hydroxy-4-methyloxolan-3-yl)amino]-2-methylsulfanylpyrimidine-5-carboxylic acid (PubChem CID 138595290) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-[(4-hydroxy-4-methyloxolan-3-yl)amino]-2-methylsulfanylpyrimidine-5-carboxylic acid.
| Compound Name | 4-[(4-hydroxy-4-methyloxolan-3-yl)amino]-2-methylsulfanylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 138595290 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-[(4-hydroxy-4-methyloxolan-3-yl)amino]-2-methylsulfanylpyrimidine-5-carboxylic acid |
| SMILES | CSc1ncc(C(=O)O)c(NC2COCC2(C)O)n1 |
| InChI | InChI=1S/C11H15N3O4S/c1-11(17)5-18-4-7(11)13-8-6(9(15)16)3-12-10(14-8)19-2/h3,7,17H,4-5H2,1-2H3,(H,15,16)(H,12,13,14) |
| InChIKey | GTWLXFJSYQBLCW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |