C30H42N2O5 — CID 138599254
(16E,18E)-11-butan-2-yl-12-methoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione (PubChem CID 138599254) has the molecular formula C30H42N2O5 and a molecular weight of 510.68 g/mol. Its IUPAC name is (16E,18E)-11-butan-2-yl-12-methoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione.
| Compound Name | (16E,18E)-11-butan-2-yl-12-methoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
|---|---|
| PubChem CID | 138599254 |
| Molecular Formula | C30H42N2O5 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | (16E,18E)-11-butan-2-yl-12-methoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
| SMILES | CCC(C)c1c(OC)cc2cc1N(C)C(=O)CCC1(C)OC1CC1CC(C/C=C/C=C(\C)C2)NC(=O)O1 |
| InChI | InChI=1S/C30H42N2O5/c1-7-20(3)28-24-15-21(16-25(28)35-6)14-19(2)10-8-9-11-22-17-23(36-29(34)31-22)18-26-30(4,37-26)13-12-27(33)32(24)5/h8-10,15-16,20,22-23,26H,7,11-14,17-18H2,1-6H3,(H,31,34)/b9-8+,19-10+ |
| InChIKey | XKSCFDMKGAOYKW-HMMGSGLESA-N |
| XLogP | 5.82 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|