C26H33ClN2O5 — CID 145202568
(1S,3S,5S,16E,18E,21S)-11-chloro-12-methoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione (PubChem CID 145202568) has the molecular formula C26H33ClN2O5 and a molecular weight of 489.01 g/mol. Its IUPAC name is (1S,3S,5S,16E,18E,21S)-11-chloro-12-methoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione.
| Compound Name | (1S,3S,5S,16E,18E,21S)-11-chloro-12-methoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
|---|---|
| PubChem CID | 145202568 |
| Molecular Formula | C26H33ClN2O5 |
| Molecular Weight | 489.01 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (1S,3S,5S,16E,18E,21S)-11-chloro-12-methoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC[C@]1(C)O[C@H]1C[C@@H]1C[C@H](C/C=C/C=C(\C)C2)NC(=O)O1 |
| InChI | InChI=1S/C26H33ClN2O5/c1-16-7-5-6-8-18-14-19(33-25(31)28-18)15-22-26(2,34-22)10-9-23(30)29(3)20-12-17(11-16)13-21(32-4)24(20)27/h5-7,12-13,18-19,22H,8-11,14-15H2,1-4H3,(H,28,31)/b6-5+,16-7+/t18-,19-,22-,26-/m0/s1 |
| InChIKey | VGHFTIZXYAGENM-KZKHXLQKSA-N |
| XLogP | 4.95 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.01 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|