C27H35ClN2O6 — CID 146228598
(1S,3S,5S,16E,18E,20R)-11-chloro-12,20-dimethoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione (PubChem CID 146228598) has the molecular formula C27H35ClN2O6 and a molecular weight of 519.04 g/mol. Its IUPAC name is (1S,3S,5S,16E,18E,20R)-11-chloro-12,20-dimethoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione.
| Compound Name | (1S,3S,5S,16E,18E,20R)-11-chloro-12,20-dimethoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
|---|---|
| PubChem CID | 146228598 |
| Molecular Formula | C27H35ClN2O6 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | (1S,3S,5S,16E,18E,20R)-11-chloro-12,20-dimethoxy-5,9,16-trimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC[C@]1(C)O[C@H]1C[C@@H]1CC(NC(=O)O1)[C@H](OC)/C=C/C=C(\C)C2 |
| InChI | InChI=1S/C27H35ClN2O6/c1-16-7-6-8-21(33-4)19-14-18(35-26(32)29-19)15-23-27(2,36-23)10-9-24(31)30(3)20-12-17(11-16)13-22(34-5)25(20)28/h6-8,12-13,18-19,21,23H,9-11,14-15H2,1-5H3,(H,29,32)/b8-6+,16-7+/t18-,19?,21+,23-,27-/m0/s1 |
| InChIKey | DKNJSRFTJSGMMC-GFEWXRIZSA-N |
| XLogP | 4.58 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|