C26H33ClN2O6 — CID 167070612
(16E,18E)-11-chloro-12,20-dimethoxy-9,16-dimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione (PubChem CID 167070612) has the molecular formula C26H33ClN2O6 and a molecular weight of 505.01 g/mol. Its IUPAC name is (16E,18E)-11-chloro-12,20-dimethoxy-9,16-dimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione.
| Compound Name | (16E,18E)-11-chloro-12,20-dimethoxy-9,16-dimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
|---|---|
| PubChem CID | 167070612 |
| Molecular Formula | C26H33ClN2O6 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (16E,18E)-11-chloro-12,20-dimethoxy-9,16-dimethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CCC1OC1CC1CC(NC(=O)O1)C(OC)/C=C/C=C(\C)C2 |
| InChI | InChI=1S/C26H33ClN2O6/c1-15-6-5-7-20(32-3)18-13-17(34-26(31)28-18)14-22-21(35-22)8-9-24(30)29(2)19-11-16(10-15)12-23(33-4)25(19)27/h5-7,11-12,17-18,20-22H,8-10,13-14H2,1-4H3,(H,28,31)/b7-5+,15-6+ |
| InChIKey | FPZXGHANSZYOEG-COVXSVHVSA-N |
| XLogP | 4.19 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|