C27H35ClN2O5 — CID 144746786
(2R,3S,5S,16E,18E)-11-chloro-12-methoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione (PubChem CID 144746786) has the molecular formula C27H35ClN2O5 and a molecular weight of 503.04 g/mol. Its IUPAC name is (2R,3S,5S,16E,18E)-11-chloro-12-methoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione.
| Compound Name | (2R,3S,5S,16E,18E)-11-chloro-12-methoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
|---|---|
| PubChem CID | 144746786 |
| Molecular Formula | C27H35ClN2O5 |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | (2R,3S,5S,16E,18E)-11-chloro-12-methoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC[C@]1(C)O[C@H]1[C@H](C)C1CC(C/C=C/C=C(\C)C2)NC(=O)O1 |
| InChI | InChI=1S/C27H35ClN2O5/c1-16-8-6-7-9-19-15-21(34-26(32)29-19)17(2)25-27(3,35-25)11-10-23(31)30(4)20-13-18(12-16)14-22(33-5)24(20)28/h6-8,13-14,17,19,21,25H,9-12,15H2,1-5H3,(H,29,32)/b7-6+,16-8+/t17-,19?,21?,25+,27+/m1/s1 |
| InChIKey | SDWLIZNZWWEVDN-UFUCTUKDSA-N |
| XLogP | 5.20 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|