C28H39ClN2O6 — CID 166933320
[(6R,9R,14E,16E)-12-amino-22-chloro-13,21-dimethoxy-2,6,9,17-tetramethyl-3-oxo-7-oxa-2-azatricyclo[17.3.1.06,8]tricosa-1(22),14,16,19(23),20-pentaen-10-yl] formate (PubChem CID 166933320) has the molecular formula C28H39ClN2O6 and a molecular weight of 535.08 g/mol. Its IUPAC name is [(6R,9R,14E,16E)-12-amino-22-chloro-13,21-dimethoxy-2,6,9,17-tetramethyl-3-oxo-7-oxa-2-azatricyclo[17.3.1.06,8]tricosa-1(22),14,16,19(23),20-pentaen-10-yl] formate.
| Compound Name | [(6R,9R,14E,16E)-12-amino-22-chloro-13,21-dimethoxy-2,6,9,17-tetramethyl-3-oxo-7-oxa-2-azatricyclo[17.3.1.06,8]tricosa-1(22),14,16,19(23),20-pentaen-10-yl] formate |
|---|---|
| PubChem CID | 166933320 |
| Molecular Formula | C28H39ClN2O6 |
| Molecular Weight | 535.08 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | [(6R,9R,14E,16E)-12-amino-22-chloro-13,21-dimethoxy-2,6,9,17-tetramethyl-3-oxo-7-oxa-2-azatricyclo[17.3.1.06,8]tricosa-1(22),14,16,19(23),20-pentaen-10-yl] formate |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC[C@@]1(C)OC1[C@H](C)C(OC=O)CC(N)C(OC)/C=C/C=C(\C)C2 |
| InChI | InChI=1S/C28H39ClN2O6/c1-17-8-7-9-22(34-5)20(30)15-23(36-16-32)18(2)27-28(3,37-27)11-10-25(33)31(4)21-13-19(12-17)14-24(35-6)26(21)29/h7-9,13-14,16,18,20,22-23,27H,10-12,15,30H2,1-6H3/b9-7+,17-8+/t18-,20?,22?,23?,27?,28-/m1/s1 |
| InChIKey | CWOTYEKFSUKYQL-QHUKWHMOSA-N |
| XLogP | 4.22 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.08 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|