C28H37ClN2O6 — CID 167189190
(16E,18E,21R)-11-chloro-6-hydroxy-20-methoxy-1,5,9,12,16-pentamethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione (PubChem CID 167189190) has the molecular formula C28H37ClN2O6 and a molecular weight of 533.07 g/mol. Its IUPAC name is (16E,18E,21R)-11-chloro-6-hydroxy-20-methoxy-1,5,9,12,16-pentamethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione.
| Compound Name | (16E,18E,21R)-11-chloro-6-hydroxy-20-methoxy-1,5,9,12,16-pentamethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
|---|---|
| PubChem CID | 167189190 |
| Molecular Formula | C28H37ClN2O6 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (16E,18E,21R)-11-chloro-6-hydroxy-20-methoxy-1,5,9,12,16-pentamethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
| SMILES | COC1/C=C/C=C(\C)Cc2cc(C)c(Cl)c(c2)N(C)C(=O)CC(O)C2(C)OC2CC2(C)C[C@H]1NC(=O)O2 |
| InChI | InChI=1S/C28H37ClN2O6/c1-16-8-7-9-21(35-6)19-14-27(3,37-26(34)30-19)15-23-28(4,36-23)22(32)13-24(33)31(5)20-12-18(10-16)11-17(2)25(20)29/h7-9,11-12,19,21-23,32H,10,13-15H2,1-6H3,(H,30,34)/b9-7+,16-8+/t19-,21?,22?,23?,27?,28?/m1/s1 |
| InChIKey | GQZSMIHRZNNBIC-UAAIKENESA-N |
| XLogP | 4.24 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|