C23H29N7O4S — CID 138611417
4-(6-aminopurin-9-yl)butyl 1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate (PubChem CID 138611417) has the molecular formula C23H29N7O4S and a molecular weight of 499.60 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)butyl 1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate.
| Compound Name | 4-(6-aminopurin-9-yl)butyl 1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 138611417 |
| Molecular Formula | C23H29N7O4S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 4-(6-aminopurin-9-yl)butyl 1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-carboxylate |
| SMILES | CS(=O)(=O)N1CC2(CCN(C(=O)OCCCCn3cnc4c(N)ncnc43)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H29N7O4S/c1-35(32,33)30-14-23(17-6-2-3-7-18(17)30)8-11-28(12-9-23)22(31)34-13-5-4-10-29-16-27-19-20(24)25-15-26-21(19)29/h2-3,6-7,15-16H,4-5,8-14H2,1H3,(H2,24,25,26) |
| InChIKey | GOEPBDQOJXPVSA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|