C19H35F — CID 138614421
1-ethyl-2-(3-ethyl-5-fluoro-3-propylhexyl)-1-methyl-3-methylidenecyclobutane (PubChem CID 138614421) has the molecular formula C19H35F and a molecular weight of 282.49 g/mol. Its IUPAC name is 1-ethyl-2-(3-ethyl-5-fluoro-3-propylhexyl)-1-methyl-3-methylidenecyclobutane.
| Compound Name | 1-ethyl-2-(3-ethyl-5-fluoro-3-propylhexyl)-1-methyl-3-methylidenecyclobutane |
|---|---|
| PubChem CID | 138614421 |
| Molecular Formula | C19H35F |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 1-ethyl-2-(3-ethyl-5-fluoro-3-propylhexyl)-1-methyl-3-methylidenecyclobutane |
| SMILES | C=C1CC(C)(CC)C1CCC(CC)(CCC)CC(C)F |
| InChI | InChI=1S/C19H35F/c1-7-11-19(9-3,14-16(5)20)12-10-17-15(4)13-18(17,6)8-2/h16-17H,4,7-14H2,1-3,5-6H3 |
| InChIKey | TWKVSZNNBPPPMQ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|