C47H61N5O2 — CID 138618216
2,6-ditert-butyl-4-[6-[2-[3,5-ditert-butyl-4-[3-(dimethylamino)propoxy]phenyl]-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]phenol (PubChem CID 138618216) has the molecular formula C47H61N5O2 and a molecular weight of 728.04 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[6-[2-[3,5-ditert-butyl-4-[3-(dimethylamino)propoxy]phenyl]-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[6-[2-[3,5-ditert-butyl-4-[3-(dimethylamino)propoxy]phenyl]-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 138618216 |
| Molecular Formula | C47H61N5O2 |
| Molecular Weight | 728.04 g/mol |
| Exact Mass | 727.48 |
| IUPAC Name | 2,6-ditert-butyl-4-[6-[2-[3,5-ditert-butyl-4-[3-(dimethylamino)propoxy]phenyl]-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]phenol |
| SMILES | CN(C)CCCOc1c(C(C)(C)C)cc(-c2nc3ccc(-c4ccc5nc(-c6cc(C(C)(C)C)c(O)c(C(C)(C)C)c6)[nH]c5c4)cc3[nH]2)cc1C(C)(C)C |
| InChI | InChI=1S/C47H61N5O2/c1-44(2,3)32-22-30(23-33(40(32)53)45(4,5)6)42-48-36-18-16-28(26-38(36)50-42)29-17-19-37-39(27-29)51-43(49-37)31-24-34(46(7,8)9)41(35(25-31)47(10,11)12)54-21-15-20-52(13)14/h16-19,22-27,53H,15,20-21H2,1-14H3,(H,48,50)(H,49,51) |
| InChIKey | JHYMEZYJJFNEKB-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.04 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|