C15H14Br2N3O+ — CID 1386286
2,4-dibromo-6-[[(3-methyl-1H-benzimidazol-3-ium-2-yl)amino]methyl]phenol (PubChem CID 1386286) has the molecular formula C15H14Br2N3O+ and a molecular weight of 412.11 g/mol. Its IUPAC name is 2,4-dibromo-6-[[(3-methyl-1H-benzimidazol-3-ium-2-yl)amino]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[[(3-methyl-1H-benzimidazol-3-ium-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 1386286 |
| Molecular Formula | C15H14Br2N3O+ |
| Molecular Weight | 412.11 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | 2,4-dibromo-6-[[(3-methyl-1H-benzimidazol-3-ium-2-yl)amino]methyl]phenol |
| SMILES | C[n+]1c(NCc2cc(Br)cc(Br)c2O)[nH]c2ccccc21 |
| InChI | InChI=1S/C15H13Br2N3O/c1-20-13-5-3-2-4-12(13)19-15(20)18-8-9-6-10(16)7-11(17)14(9)21/h2-7H,8H2,1H3,(H2,18,19,21)/p+1 |
| InChIKey | SWSKEIMKVZKDSR-UHFFFAOYSA-O |
| XLogP | 3.84 |
| TPSA | 51.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.11 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|