C20H38N4O3S2 — CID 138630517
N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-4-methyl-2-[(3-methyldithiolan-4-yl)amino]pentanamide (PubChem CID 138630517) has the molecular formula C20H38N4O3S2 and a molecular weight of 446.68 g/mol. Its IUPAC name is N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-4-methyl-2-[(3-methyldithiolan-4-yl)amino]pentanamide.
| Compound Name | N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-4-methyl-2-[(3-methyldithiolan-4-yl)amino]pentanamide |
|---|---|
| PubChem CID | 138630517 |
| Molecular Formula | C20H38N4O3S2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]-4-methyl-2-[(3-methyldithiolan-4-yl)amino]pentanamide |
| SMILES | CC(C)CC(NC1CSSC1C)C(=O)NC(CCCNC(N)=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C20H38N4O3S2/c1-12(2)10-15(23-16-11-28-29-13(16)3)18(26)24-14(17(25)20(4,5)6)8-7-9-22-19(21)27/h12-16,23H,7-11H2,1-6H3,(H,24,26)(H3,21,22,27) |
| InChIKey | DKXBRLGUEBOUDB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|