C17H33N3O3 — CID 158193813
[7-amino-4-(2,2-dimethylpropanoyl)-9-methyl-6-oxodecyl]urea (PubChem CID 158193813) has the molecular formula C17H33N3O3 and a molecular weight of 327.47 g/mol. Its IUPAC name is [7-amino-4-(2,2-dimethylpropanoyl)-9-methyl-6-oxodecyl]urea.
| Compound Name | [7-amino-4-(2,2-dimethylpropanoyl)-9-methyl-6-oxodecyl]urea |
|---|---|
| PubChem CID | 158193813 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | [7-amino-4-(2,2-dimethylpropanoyl)-9-methyl-6-oxodecyl]urea |
| SMILES | CC(C)CC(N)C(=O)CC(CCCNC(N)=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H33N3O3/c1-11(2)9-13(18)14(21)10-12(15(22)17(3,4)5)7-6-8-20-16(19)23/h11-13H,6-10,18H2,1-5H3,(H3,19,20,23) |
| InChIKey | ZEDNVNNVUPECKD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|