C28H52FN7O2 — CID 138645675
1-[3-[[3,3-diamino-2-[(4R)-4-butyl-7-fluoro-4-methyl-3,5,6,7-tetrahydro-2H-azocin-2-yl]propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide (PubChem CID 138645675) has the molecular formula C28H52FN7O2 and a molecular weight of 537.77 g/mol. Its IUPAC name is 1-[3-[[3,3-diamino-2-[(4R)-4-butyl-7-fluoro-4-methyl-3,5,6,7-tetrahydro-2H-azocin-2-yl]propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide.
| Compound Name | 1-[3-[[3,3-diamino-2-[(4R)-4-butyl-7-fluoro-4-methyl-3,5,6,7-tetrahydro-2H-azocin-2-yl]propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 138645675 |
| Molecular Formula | C28H52FN7O2 |
| Molecular Weight | 537.77 g/mol |
| Exact Mass | 537.42 |
| IUPAC Name | 1-[3-[[3,3-diamino-2-[(4R)-4-butyl-7-fluoro-4-methyl-3,5,6,7-tetrahydro-2H-azocin-2-yl]propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide |
| SMILES | CCCC[C@]1(C)CCC(F)/C=N\C(C(C(=O)NC2CNCCC2N2CCCC(C(=O)N(C)C)C2)C(N)N)C1 |
| InChI | InChI=1S/C28H52FN7O2/c1-5-6-11-28(2)12-9-20(29)16-33-21(15-28)24(25(30)31)26(37)34-22-17-32-13-10-23(22)36-14-7-8-19(18-36)27(38)35(3)4/h16,19-25,32H,5-15,17-18,30-31H2,1-4H3,(H,34,37)/b33-16-/t19?,20?,21?,22?,23?,24?,28-/m1/s1 |
| InChIKey | AIPIZHQVRXYKQY-QCWMRHDFSA-N |
| XLogP | 1.65 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.77 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|