C15H11ClF4N2 — CID 138652587
4-chloro-3-[1-[4-fluoro-3-(trifluoromethyl)anilino]ethenyl]aniline (PubChem CID 138652587) has the molecular formula C15H11ClF4N2 and a molecular weight of 330.71 g/mol. Its IUPAC name is 4-chloro-3-[1-[4-fluoro-3-(trifluoromethyl)anilino]ethenyl]aniline.
| Compound Name | 4-chloro-3-[1-[4-fluoro-3-(trifluoromethyl)anilino]ethenyl]aniline |
|---|---|
| PubChem CID | 138652587 |
| Molecular Formula | C15H11ClF4N2 |
| Molecular Weight | 330.71 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-chloro-3-[1-[4-fluoro-3-(trifluoromethyl)anilino]ethenyl]aniline |
| SMILES | C=C(Nc1ccc(F)c(C(F)(F)F)c1)c1cc(N)ccc1Cl |
| InChI | InChI=1S/C15H11ClF4N2/c1-8(11-6-9(21)2-4-13(11)16)22-10-3-5-14(17)12(7-10)15(18,19)20/h2-7,22H,1,21H2 |
| InChIKey | XIWDQGWQCFLIOF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.71 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|