C23H15Cl5N4O4 — CID 138652653
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[5-[formyl(hydroxy)amino]-2-pyridinyl]benzamide (PubChem CID 138652653) has the molecular formula C23H15Cl5N4O4 and a molecular weight of 588.66 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[5-[formyl(hydroxy)amino]-2-pyridinyl]benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[5-[formyl(hydroxy)amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 138652653 |
| Molecular Formula | C23H15Cl5N4O4 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 585.95 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-[5-[formyl(hydroxy)amino]-2-pyridinyl]benzamide |
| SMILES | O=CN(O)c1ccc(NC(=O)c2cc(NC(=O)C3C(c4cc(Cl)cc(Cl)c4)C3(Cl)Cl)ccc2Cl)nc1 |
| InChI | InChI=1S/C23H15Cl5N4O4/c24-12-5-11(6-13(25)7-12)19-20(23(19,27)28)22(35)30-14-1-3-17(26)16(8-14)21(34)31-18-4-2-15(9-29-18)32(36)10-33/h1-10,19-20,36H,(H,30,35)(H,29,31,34) |
| InChIKey | HQBBHSWHIDWBLJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|