C22H15Cl5FN3O2 — CID 138653853
2-chloro-N-(1-cyanocyclopropyl)-5-[[2,2-dichloro-3-(3,5-dichloro-4-fluorophenyl)-1-formylcyclopropyl]methylamino]benzamide (PubChem CID 138653853) has the molecular formula C22H15Cl5FN3O2 and a molecular weight of 549.64 g/mol. Its IUPAC name is 2-chloro-N-(1-cyanocyclopropyl)-5-[[2,2-dichloro-3-(3,5-dichloro-4-fluorophenyl)-1-formylcyclopropyl]methylamino]benzamide.
| Compound Name | 2-chloro-N-(1-cyanocyclopropyl)-5-[[2,2-dichloro-3-(3,5-dichloro-4-fluorophenyl)-1-formylcyclopropyl]methylamino]benzamide |
|---|---|
| PubChem CID | 138653853 |
| Molecular Formula | C22H15Cl5FN3O2 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 546.96 |
| IUPAC Name | 2-chloro-N-(1-cyanocyclopropyl)-5-[[2,2-dichloro-3-(3,5-dichloro-4-fluorophenyl)-1-formylcyclopropyl]methylamino]benzamide |
| SMILES | N#CC1(NC(=O)c2cc(NCC3(C=O)C(c4cc(Cl)c(F)c(Cl)c4)C3(Cl)Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C22H15Cl5FN3O2/c23-14-2-1-12(7-13(14)19(33)31-20(8-29)3-4-20)30-9-21(10-32)18(22(21,26)27)11-5-15(24)17(28)16(25)6-11/h1-2,5-7,10,18,30H,3-4,9H2,(H,31,33) |
| InChIKey | GQRLEIQMBKREOA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|