C20H14Br2Cl3F3N2O2 — CID 138650541
2-chloro-5-[[2,2-dibromo-3-(3,5-dichlorophenyl)-1-formylcyclopropyl]methylamino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 138650541) has the molecular formula C20H14Br2Cl3F3N2O2 and a molecular weight of 637.50 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dibromo-3-(3,5-dichlorophenyl)-1-formylcyclopropyl]methylamino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dibromo-3-(3,5-dichlorophenyl)-1-formylcyclopropyl]methylamino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 138650541 |
| Molecular Formula | C20H14Br2Cl3F3N2O2 |
| Molecular Weight | 637.50 g/mol |
| Exact Mass | 633.84 |
| IUPAC Name | 2-chloro-5-[[2,2-dibromo-3-(3,5-dichlorophenyl)-1-formylcyclopropyl]methylamino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=CC1(CNc2ccc(Cl)c(C(=O)NCC(F)(F)F)c2)C(c2cc(Cl)cc(Cl)c2)C1(Br)Br |
| InChI | InChI=1S/C20H14Br2Cl3F3N2O2/c21-20(22)16(10-3-11(23)5-12(24)4-10)18(20,9-31)7-29-13-1-2-15(25)14(6-13)17(32)30-8-19(26,27)28/h1-6,9,16,29H,7-8H2,(H,30,32) |
| InChIKey | NNLLLDYNQIOYIE-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|