C26H19Cl4FN2O2 — CID 146269615
2-chloro-5-[[2,2-dichloro-3-(4-chloro-3-ethenylphenyl)-1-formylcyclopropyl]methylamino]-N-(4-fluorophenyl)benzamide (PubChem CID 146269615) has the molecular formula C26H19Cl4FN2O2 and a molecular weight of 552.26 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(4-chloro-3-ethenylphenyl)-1-formylcyclopropyl]methylamino]-N-(4-fluorophenyl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(4-chloro-3-ethenylphenyl)-1-formylcyclopropyl]methylamino]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 146269615 |
| Molecular Formula | C26H19Cl4FN2O2 |
| Molecular Weight | 552.26 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(4-chloro-3-ethenylphenyl)-1-formylcyclopropyl]methylamino]-N-(4-fluorophenyl)benzamide |
| SMILES | C=Cc1cc(C2C(Cl)(Cl)C2(C=O)CNc2ccc(Cl)c(C(=O)Nc3ccc(F)cc3)c2)ccc1Cl |
| InChI | InChI=1S/C26H19Cl4FN2O2/c1-2-15-11-16(3-9-21(15)27)23-25(14-34,26(23,29)30)13-32-19-8-10-22(28)20(12-19)24(35)33-18-6-4-17(31)5-7-18/h2-12,14,23,32H,1,13H2,(H,33,35) |
| InChIKey | FXWGDOWBTHVVQT-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.26 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|