C24H16Cl4FIN2O2 — CID 146269629
5-[[2,2-dichloro-3-(3,5-dichlorophenyl)-1-formylcyclopropyl]methylamino]-N-(4-fluorophenyl)-2-iodobenzamide (PubChem CID 146269629) has the molecular formula C24H16Cl4FIN2O2 and a molecular weight of 652.12 g/mol. Its IUPAC name is 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)-1-formylcyclopropyl]methylamino]-N-(4-fluorophenyl)-2-iodobenzamide.
| Compound Name | 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)-1-formylcyclopropyl]methylamino]-N-(4-fluorophenyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 146269629 |
| Molecular Formula | C24H16Cl4FIN2O2 |
| Molecular Weight | 652.12 g/mol |
| Exact Mass | 649.90 |
| IUPAC Name | 5-[[2,2-dichloro-3-(3,5-dichlorophenyl)-1-formylcyclopropyl]methylamino]-N-(4-fluorophenyl)-2-iodobenzamide |
| SMILES | O=CC1(CNc2ccc(I)c(C(=O)Nc3ccc(F)cc3)c2)C(c2cc(Cl)cc(Cl)c2)C1(Cl)Cl |
| InChI | InChI=1S/C24H16Cl4FIN2O2/c25-14-7-13(8-15(26)9-14)21-23(12-33,24(21,27)28)11-31-18-5-6-20(30)19(10-18)22(34)32-17-3-1-16(29)2-4-17/h1-10,12,21,31H,11H2,(H,32,34) |
| InChIKey | BRBGLYOXYBQOAY-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.12 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|