About 3-methylbut-2-en-2-yl thiohypofluorite
3-methylbut-2-en-2-yl thiohypofluorite (PubChem CID 138655385) has the molecular formula C5H9FS
and a molecular weight of 120.19 g/mol. Its IUPAC name is 3-methylbut-2-en-2-yl thiohypofluorite.
Molecular Properties
| Compound Name | 3-methylbut-2-en-2-yl thiohypofluorite |
| PubChem CID | 138655385 |
| Molecular Formula | C5H9FS |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 3-methylbut-2-en-2-yl thiohypofluorite |
| SMILES | CC(C)=C(C)SF |
| InChI | InChI=1S/C5H9FS/c1-4(2)5(3)7-6/h1-3H3 |
| InChIKey | IMAUBLPXGDSRDR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylbut-2-en-2-yl thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-en-2-yl thiohypofluorite?
The IUPAC name of 3-methylbut-2-en-2-yl thiohypofluorite (CID 138655385) is 3-methylbut-2-en-2-yl thiohypofluorite.
What is the SMILES notation for 3-methylbut-2-en-2-yl thiohypofluorite?
The canonical SMILES for 3-methylbut-2-en-2-yl thiohypofluorite is CC(C)=C(C)SF.
What is the InChIKey of 3-methylbut-2-en-2-yl thiohypofluorite?
The InChIKey is IMAUBLPXGDSRDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FS/c1-4(2)5(3)7-6/h1-3H3.
What are the key properties of 3-methylbut-2-en-2-yl thiohypofluorite?
3-methylbut-2-en-2-yl thiohypofluorite has a molecular weight of 120.19 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-en-2-yl thiohypofluorite is sourced from PubChem (CID 138655385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).