C8H12N2 — CID 138655682
(2Z,4Z)-2-ethynylhexa-2,4-diene-1,3-diamine (PubChem CID 138655682) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (2Z,4Z)-2-ethynylhexa-2,4-diene-1,3-diamine.
| Compound Name | (2Z,4Z)-2-ethynylhexa-2,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 138655682 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (2Z,4Z)-2-ethynylhexa-2,4-diene-1,3-diamine |
| SMILES | C#C/C(CN)=C(N)\C=C/C |
| InChI | InChI=1S/C8H12N2/c1-3-5-8(10)7(4-2)6-9/h2-3,5H,6,9-10H2,1H3/b5-3-,8-7- |
| InChIKey | NROMCISEMKQQAE-OVRZELKPSA-N |
| XLogP | 0.37 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|