C34H29N9O3S2 — CID 138667211
2-[7-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]carbamate (PubChem CID 138667211) has the molecular formula C34H29N9O3S2 and a molecular weight of 675.80 g/mol. Its IUPAC name is 2-[7-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]carbamate.
| Compound Name | 2-[7-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 138667211 |
| Molecular Formula | C34H29N9O3S2 |
| Molecular Weight | 675.80 g/mol |
| Exact Mass | 675.18 |
| IUPAC Name | 2-[7-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]carbamate |
| SMILES | N#C/C(=C\c1ccc2c(c1)SCCN2CCOC(=O)NCc1ccc(COc2nc(N)nc3nc[nH]c23)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C34H29N9O3S2/c35-17-24(32-40-25-3-1-2-4-27(25)48-32)15-23-9-10-26-28(16-23)47-14-12-43(26)11-13-45-34(44)37-18-21-5-7-22(8-6-21)19-46-31-29-30(39-20-38-29)41-33(36)42-31/h1-10,15-16,20H,11-14,18-19H2,(H,37,44)(H3,36,38,39,41,42)/b24-15+ |
| InChIKey | BYYKCBVCFHQLLJ-BUVRLJJBSA-N |
| XLogP | 6.03 |
| TPSA | 167.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.80 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|