C39H36N8O4 — CID 158355452
2-[6-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2,2,4-trimethylquinolin-1-yl]ethyl N-[[4-[(2-amino-7H-pyrrolo[3,2-d]pyrimidin-4-yl)oxymethyl]phenyl]methyl]carbamate (PubChem CID 158355452) has the molecular formula C39H36N8O4 and a molecular weight of 680.77 g/mol. Its IUPAC name is 2-[6-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2,2,4-trimethylquinolin-1-yl]ethyl N-[[4-[(2-amino-7H-pyrrolo[3,2-d]pyrimidin-4-yl)oxymethyl]phenyl]methyl]carbamate.
| Compound Name | 2-[6-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2,2,4-trimethylquinolin-1-yl]ethyl N-[[4-[(2-amino-7H-pyrrolo[3,2-d]pyrimidin-4-yl)oxymethyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 158355452 |
| Molecular Formula | C39H36N8O4 |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.29 |
| IUPAC Name | 2-[6-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2,2,4-trimethylquinolin-1-yl]ethyl N-[[4-[(2-amino-7H-pyrrolo[3,2-d]pyrimidin-4-yl)oxymethyl]phenyl]methyl]carbamate |
| SMILES | CC1=CC(C)(C)N(CCOC(=O)NCc2ccc(COc3nc(N)nc4c3N=CC4)cc2)c2ccc(/C=C(\C#N)c3nc4ccccc4o3)cc21 |
| InChI | InChI=1S/C39H36N8O4/c1-24-20-39(2,3)47(32-13-12-27(19-29(24)32)18-28(21-40)35-44-30-6-4-5-7-33(30)51-35)16-17-49-38(48)43-22-25-8-10-26(11-9-25)23-50-36-34-31(14-15-42-34)45-37(41)46-36/h4-13,15,18-20H,14,16-17,22-23H2,1-3H3,(H,43,48)(H2,41,45,46)/b28-18+ |
| InChIKey | YMOBOWZJJNOPPA-MTDXEUNCSA-N |
| XLogP | 7.03 |
| TPSA | 164.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|