C11H22FOP — CID 138672233
2-fluoro-2,3-dimethyl-1-(2-methylbutylphosphanyl)butan-1-one (PubChem CID 138672233) has the molecular formula C11H22FOP and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-fluoro-2,3-dimethyl-1-(2-methylbutylphosphanyl)butan-1-one.
| Compound Name | 2-fluoro-2,3-dimethyl-1-(2-methylbutylphosphanyl)butan-1-one |
|---|---|
| PubChem CID | 138672233 |
| Molecular Formula | C11H22FOP |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2-fluoro-2,3-dimethyl-1-(2-methylbutylphosphanyl)butan-1-one |
| SMILES | CCC(C)CPC(=O)C(C)(F)C(C)C |
| InChI | InChI=1S/C11H22FOP/c1-6-9(4)7-14-10(13)11(5,12)8(2)3/h8-9,14H,6-7H2,1-5H3 |
| InChIKey | REJJFFVEFMPZSB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|