C20H30ClN5O7 — CID 138673437
2-[4,7-bis(carboxymethyl)-10-[(4-chloro-1-oxidopyridin-1-ium-2-yl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 138673437) has the molecular formula C20H30ClN5O7 and a molecular weight of 487.94 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[(4-chloro-1-oxidopyridin-1-ium-2-yl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[(4-chloro-1-oxidopyridin-1-ium-2-yl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 138673437 |
| Molecular Formula | C20H30ClN5O7 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[(4-chloro-1-oxidopyridin-1-ium-2-yl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(Cc2cc(Cl)cc[n+]2[O-])CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H30ClN5O7/c21-16-1-2-26(33)17(11-16)12-22-3-5-23(13-18(27)28)7-9-25(15-20(31)32)10-8-24(6-4-22)14-19(29)30/h1-2,11H,3-10,12-15H2,(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | OGXHVSIDYMJFMG-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|