C24H34N6O6 — CID 155351546
2-[7-(2-amino-2-oxoethyl)-4-(carboxymethyl)-10-[(2-oxidoisoquinolin-2-ium-1-yl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 155351546) has the molecular formula C24H34N6O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is 2-[7-(2-amino-2-oxoethyl)-4-(carboxymethyl)-10-[(2-oxidoisoquinolin-2-ium-1-yl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[7-(2-amino-2-oxoethyl)-4-(carboxymethyl)-10-[(2-oxidoisoquinolin-2-ium-1-yl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 155351546 |
| Molecular Formula | C24H34N6O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 2-[7-(2-amino-2-oxoethyl)-4-(carboxymethyl)-10-[(2-oxidoisoquinolin-2-ium-1-yl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | NC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(Cc2c3ccccc3cc[n+]2[O-])CC1 |
| InChI | InChI=1S/C24H34N6O6/c25-22(31)16-27-9-7-26(15-21-20-4-2-1-3-19(20)5-6-30(21)36)8-11-28(17-23(32)33)13-14-29(12-10-27)18-24(34)35/h1-6H,7-18H2,(H2,25,31)(H,32,33)(H,34,35) |
| InChIKey | WBLYUTMCZFVGQB-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 157.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|