C28H29F3N2O7S — CID 138677160
N-[2-[acetyl-[(7S)-1,2-dimethoxy-10-methylsulfanyl-9-oxo-3-prop-2-enoxy-6,7-dihydro-5H-benzo[a]heptalen-7-yl]amino]-2-oxoethyl]-2,2,2-trifluoroacetamide (PubChem CID 138677160) has the molecular formula C28H29F3N2O7S and a molecular weight of 594.61 g/mol. Its IUPAC name is N-[2-[acetyl-[(7S)-1,2-dimethoxy-10-methylsulfanyl-9-oxo-3-prop-2-enoxy-6,7-dihydro-5H-benzo[a]heptalen-7-yl]amino]-2-oxoethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[acetyl-[(7S)-1,2-dimethoxy-10-methylsulfanyl-9-oxo-3-prop-2-enoxy-6,7-dihydro-5H-benzo[a]heptalen-7-yl]amino]-2-oxoethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 138677160 |
| Molecular Formula | C28H29F3N2O7S |
| Molecular Weight | 594.61 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | N-[2-[acetyl-[(7S)-1,2-dimethoxy-10-methylsulfanyl-9-oxo-3-prop-2-enoxy-6,7-dihydro-5H-benzo[a]heptalen-7-yl]amino]-2-oxoethyl]-2,2,2-trifluoroacetamide |
| SMILES | C=CCOc1cc2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1[C@@H](N(C(C)=O)C(=O)CNC(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C28H29F3N2O7S/c1-6-11-40-21-12-16-7-9-19(33(15(2)34)23(36)14-32-27(37)28(29,30)31)18-13-20(35)22(41-5)10-8-17(18)24(16)26(39-4)25(21)38-3/h6,8,10,12-13,19H,1,7,9,11,14H2,2-5H3,(H,32,37)/t19-/m0/s1 |
| InChIKey | IQIZEWOIPACBCD-IBGZPJMESA-N |
| XLogP | 4.06 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|